RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2021 |
| Common Name | 6-Deoxoteasterone |
| Formula | C28H50O3 |
| Formula at pH 7.2 (Predicted) | C28H50O3 |
| Molecular Weight | 434.695 |
| Structure |  |
| SMILES | CC(C)C(C)C(O)C(O)C(C)C1(C2(C)(C(CC1)C3(C(CC2)C4([CH](CC3)CC(O)CC4)(C)))) |
| Reactions | OSR1412 OSR1463 |
| Pathways | |
|---|---|
| KEGG | rn00905 rn01100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-715 |
| KEGG | C15799 |
| Pubchem Compound | 23724591 |
| Pubchem Substance | 47205124 |