RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2024 |
| Common Name | alpha-Tocopherol |
| Synonyms Names | Vitamin E |
| Formula | C29H50O2 |
| Formula at pH 7.2 (Predicted) | C29H50O2 |
| Molecular Weight | 430.706 |
| Structure |  |
| SMILES | CC2(=C1(OC(CCC1=C(C)C(O)=C2C)(C)CCCC(C)CCCC(C)CCCC(C)C)) |
| Reactions | OSR2353 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C02477 |
| ChEBI | 18145 |
| Pubchem Compound | 14985 |
| Pubchem Substance | 5492 |