RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2028 |
| Common Name | Lanosterol |
| Synonyms Names | 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol |
| Formula | C30H50O |
| Formula at pH 7.2 (Predicted) | C30H50O |
| Molecular Weight | 426.717 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)C1(C2(C)(C(C)(CC1)C3(=C(CC2)C4(C)(C(CC3)C(C)(C)C(O)CC4)))) |
| Reactions | OSR1437 OSR2757 OSR2774 OSR2777 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 |
| Database Links | |
|---|---|
| KEGG | C01724 |
| ChEBI | 16521 |