RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2029 |
| Common Name | Cycloartenol |
| Synonyms Names | 9beta,19-Cyclo-24-lanosten-3beta-ol |
| Formula | C30H50O |
| Formula at pH 7.2 (Predicted) | C30H50O |
| Molecular Weight | 426.717 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)C1(C5(C)(C(C)(CC1)C2(C4(C3([CH](CC2)C(C)(C)C(O)CC3)(C4))(CC5)))) |
| Reactions | OSR1422 OSR2401 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| KEGG | C01902 |
| ChEBI | 17030 |