RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2030 |
| Common Name | (S)-2,3-Epoxysqualene |
| Synonyms Names | Squalene 2,3-epoxide ;Squalene 2,3-oxide ;(S)-Squalene-2,3-epoxide |
| Formula | C30H50O |
| Formula at pH 7.2 (Predicted) | C30H50O |
| Molecular Weight | 426.717 |
| Structure |  |
| SMILES | CC(CCC1(C(O1)(C)C))=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C |
| Reactions | OSR1422 OSR1437 OSR1504 OSR2771 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 rn00909 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| KEGG | C01054 |
| ChEBI | 15441 |
| Pubchem Compound | 5280395 |
| Pubchem Substance | 4295 |