RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2039 |
| Common Name | 24,25-Dihydrolanosterol |
| Formula | C30H52O |
| Formula at pH 7.2 (Predicted) | C30H52O |
| Molecular Weight | 428.733 |
| Structure |  |
| SMILES | CC(C)CCCC(C)C1(C2(C(CC1)(C)C3(=C(CC2)C4(C(CC3)C(C)(C)C(O)CC4)(C)))(C)) |
| Reactions | OSR2757 OSR2787 |
| Pathways | |
|---|---|
| KEGG | rn00100 |
| Database Links | |
|---|---|
| Gramene | CPD-8606 |
| KEGG | C05109 |
| ChEBI | 28113 |
| Pubchem Compound | 440560 |
| Pubchem Substance | 7535 |