RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2041 |
| Common Name | m7G(5')pppAm |
| Formula | C22H31N10O17P3 |
| Formula at pH 7.2 (Predicted) | C22H28N10O17P32- |
| Molecular Weight | 800.465 |
| Structure |  |
| SMILES | c6(=O)(c5([n+](C)cn(C4([H])(OC([H])(COP(O)(=O)OP(O)(=O)OP(=O)(O)OCC3([H])(C(O)([H])C([H])(OC)C([H])(n2(c1(ncnc(N)c1nc2)))O3))C(O)([H])C(O)([H])4))c5nc(N)n6)) |
| Reactions | OSR2880 |
| Database Links | |
|---|---|
| Gramene | CPD-8628 |