RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2042 |
| Common Name | 4,4-dimethyl-14alpha-hydroxymethyl-5alpha-cholesta-8-en-3beta-ol |
| Formula | C30H52O2 |
| Formula at pH 7.2 (Predicted) | C30H52O2 |
| Molecular Weight | 444.74 |
| Structure |  |
| SMILES | OCC12CCC(C2(C)CCC2=C1CCC1C2(C)CCC(C1(C)C)O)C(CCCC(C)C)C |
| Reactions | OSR2784 OSR2787 |
| Database Links | |
|---|---|
| Gramene | CPD-8607 |