RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2043 |
| Common Name | 24-Methylenecycloartanol |
| Synonyms Names | 9,19-Cyclolanostan-3-o1, 24-methylene-, (3beta)- |
| Formula | C31H52O |
| Formula at pH 7.2 (Predicted) | C31H52O |
| Molecular Weight | 440.744 |
| Structure |  |
| SMILES | CC(C)C(=C)CCC(C)C1(C5(C)(C(C)(CC1)C2(C4(C3([CH](CC2)C(C)(C)C(O)CC3)(C4))(CC5)))) |
| Reactions | OSR1459 OSR2401 OSR2520 |
| Pathways | |
|---|---|
| KEGG | rn00100 rn01100 rn01110 |
| Metacyc | PWY-2541 |
| Database Links | |
|---|---|
| Gramene | CPD-696 |
| KEGG | C08830 |
| Pubchem Compound | 94204 |
| Pubchem Substance | 11023 |