RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2046 |
| Common Name | RCC |
| Synonyms Names | Red chlorophyll catabolite |
| Formula | C35H38N4O7 |
| Formula at pH 7.2 (Predicted) | C35H36N4O72- |
| Molecular Weight | 626.708 |
| Structure |  |
| SMILES | COC(=O)C1C(=O)c2c(C1=C1N=C(C(C1CCC(=O)O)C)C=C1NC(=O)C(=C1C)C=C)[nH]c(c2C)Cc1[nH]c(c(c1CC)C)C=O |
| Reactions | OSR2773 OSR2893 OSR2898 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01110 |
| Metacyc | PWY-5098 |
| Database Links | |
|---|---|
| Gramene | CPD-7063 |
| KEGG | C18022 |
| Pubchem Compound | 46174034 |
| Pubchem Substance | 96024242 |