RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2049 |
| Common Name | UDP-N-acetylmuramoyl-L-alanine |
| Formula | C23H36N4O20P2 |
| Formula at pH 7.2 (Predicted) | C23H33N4O20P23- |
| Molecular Weight | 750.5 |
| Structure |  |
| SMILES | OCC1OC(OP(=O)(OP(=O)(OCC2OC(C(C2O)O)n2ccc(=O)[nH]c2=O)O)O)C(C(C1O)OC(C(=O)NC(C(=O)O)C)C)NC(=O)C |
| Reactions | OSR2463 OSR2624 |
| Pathways | |
|---|---|
| Metacyc | PEPTIDOGLYCANSYN-PWY |