RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2050 |
| Common Name | Primary fluorescent chlorophyll catabolite |
| Formula | C35H40N4O7 |
| Formula at pH 7.2 (Predicted) | C35H38N4O72- |
| Molecular Weight | 628.715 |
| Structure |  |
| SMILES | CCc1(c(nc([CH]=O)c(C)1)Cc2(c(C)c3(c(n2)C(C(C(=O)3)C(=O)OC)=C4(N=C(C(C)C4CCC(=O)O)CC5(C(C)=C(C=C)C(=O)N5))))) |
| Reactions | OSR2898 |
| Pathways | |
|---|---|
| Metacyc | PWY-5098 |
| Database Links | |
|---|---|
| Gramene | CPD-7064 |
| KEGG | C18098 |
| Pubchem Compound | 23657843 |
| Pubchem Substance | 96024315 |