RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2051 |
| Common Name | m7G(5')pppm6Am |
| Formula | C23H33N10O17P3 |
| Formula at pH 7.2 (Predicted) | C23H30N10O17P32- |
| Molecular Weight | 815.5 |
| Structure |  |
| SMILES | c1(nc2(c(c(n1)NC)ncn2C3(C(C(C(O3)(COP(OP(OP(OCC4(OC(C(C4(O)[H])(O)[H])([H])n5(c6(nc(nc(c([n+](c5)C)6)=O)N)))[H])(O)=O)(O)=O)(=O)O)[H])(O)[H])(OC)[H])[H])) |
| Reactions | OSR2880 |
| Database Links | |
|---|---|
| Gramene | CPD-8629 |