RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2056 |
| Common Name | Cis-2-enoyl-CoAs |
| Formula | C24H33N7O17R1P3S |
| Formula at pH 7.2 (Predicted) | C24H33O17N7P3S1R14- |
| Structure |  |
| SMILES | C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C1OP([O-])([O-])=O)n2(cnc3(c2ncnc3N))))(C=C[R1])=O |
| Reactions | OSR1696 |
| Pathways | |
|---|---|
| Metacyc | PWY-5138 |