RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2060 |
| Common Name | Stachyose |
| Formula | C24H42O21 |
| Formula at pH 7.2 (Predicted) | C24H42O21 |
| Molecular Weight | 666.578 |
| Structure |  |
| SMILES | C(O)C1(OC(CO)(C(O)C1O)OC2(OC(C(O)C(O)C2O)COC3(OC(C(O)C(O)C3O)COC4(C(O)C(O)C(O)C(O4)CO)))) |
| Reactions | OSR1166 OSR1398 OSR1625 OSR1634 OSR2117 |
| Pathways | |
|---|---|
| KEGG | rn00052 rn00561 rn00603 rn00600 |
| Metacyc | PWY0-1301 PWY-6527 |
| Database Links | |
|---|---|
| Gramene | CPD-170 |
| KEGG | C01613 |
| ChEBI | 17164 |
| Pubchem Compound | 439531 |
| Pubchem Substance | 4765 |