RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2068 |
| Common Name | FADH2 |
| Formula | C27H35N9O15P2 |
| Formula at pH 7.2 (Predicted) | C27H33N9O15P22- |
| Molecular Weight | 787.566 |
| Structure |  |
| SMILES | CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO[P](O)(=O)O[P](O)(=O)OCC3OC(C(O)C3O)[N]4C=NC5=C(N)N=CN=C45)C6=C(N2)C(=O)NC(=O)N6 |
| Reactions | OSR1956 OSR1992 OSR2233 OSR2240 OSR2247 OSR2452 OSR2465 OSR2854 OSR2875 OSR2878 OSR2887 OSR2890 OSR2891 OSR2899 OSR2910 OSR2926 OSR2946 OSR2956 OSR2959 OSR2969 OSR2971 OSR2982 OSR2983 OSR2993 OSR3001 OSR3005 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn00908 rn00410 rn00071 rn01100 rn00280 rn00592 rn00860 rn01040 |
| Metacyc | PROUT-PWY CITRULBIO-PWY PWY-4261 PWY-2841 PWY-3941 FAO-PWY |
| Database Links | |
|---|---|
| KEGG | C01352 |
| ChEBI | 17877 |