RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2070 |
| Common Name | Coenzyme F420 |
| Formula | C29H36N5O18P |
| Formula at pH 7.2 (Predicted) | C29H32N5O18P4- |
| Molecular Weight | 773.593 |
| Structure |  |
| SMILES | O=C(NC(C(=O)O)CCC(=O)O)CCC(C(=O)O)NC(=O)C(OP(=O)(OCC(C(C(Cn1c2cc(=O)ccc2cc2c1[nH]c(=O)[nH]c2=O)O)O)O)O)C |
| Reactions | OSR1670 |
| Pathways | |
|---|---|
| KEGG | rn00680 rn01100 rn01120 |
| Database Links | |
|---|---|
| KEGG | C00876 |
| ChEBI | 16848 |
| Pubchem Compound | 123996 |
| Pubchem Substance | 4132 |