RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2076 |
| Common Name | Leukotriene C4 |
| Synonyms Names | LTC4 |
| Formula | C30H47N3O9S |
| Formula at pH 7.2 (Predicted) | C30H45N3O9S2- |
| Molecular Weight | 625.774 |
| Structure |  |
| SMILES | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |
| Reactions | OSR1896 |
| Pathways | |
|---|---|
| KEGG | rn00590 rn01100 |
| Database Links | |
|---|---|
| KEGG | C02166 |
| ChEBI | 16978 |
| Pubchem Compound | 5280493 |
| Pubchem Substance | 5241 |