RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2077 |
| Common Name | Propenoyl-CoA |
| Synonyms Names | Acryloyl-CoA ;Acrylyl-CoA |
| Formula | C24H38N7O17P3S |
| Formula at pH 7.2 (Predicted) | C24H34N7O17P3S4- |
| Molecular Weight | 821.582 |
| Structure |  |
| SMILES | CC(C)(CO[P](O)(=O)O[P](O)(=O)OCC1OC(C(O)C1O[P](O)(O)=O)[N]2C=NC3=C2N=CN=C3N)C(O)C(=O)NCCC(=O)NCCSC(=O)C=C |
| Reactions | OSR1705 OSR1716 OSR2854 OSR2923 OSR3020 |
| Pathways | |
|---|---|
| KEGG | rn00410 rn00640 rn00720 rn01100 rn01120 |
| Metacyc | PWY-3941 PROPFERM-PWY |
| Database Links | |
|---|---|
| KEGG | C00894 |
| ChEBI | 15513 |