RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2078 |
| Common Name | TRANS-D2-ENOYL-COA |
| Formula | C24H37N7O17RP3S |
| Formula at pH 7.2 (Predicted) | C24H33O17N7P3S1R1 |
| Structure |  |
| SMILES | n1(cnc2(c(ncnc12)N))(C3(OC(COP(=O)(O)OP(OCC(C(O)C(NCCC(=O)NCCSC(=O)C=C[R])=O)(C)C)(=O)O)(C(C([H])3O)(OP(O)(=O)O)[H])[H])[H]) |
| Reactions | OSR1612 OSR1615 OSR1666 OSR1704 OSR1707 OSR1745 OSR2796 |
| Pathways | |
|---|---|
| Metacyc | PWY-5136 PWY-5080 FAO-PWY PWY-5138 |