RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2079 |
| Common Name | L-methionyl-tRNAMet |
| Synonyms Names | L-Methionyl-tRNA ;L-Methionyl-tRNA(Met) ;C02430 ;L-METHIONYL-TRNA ;L-METHIONYL-TRNA(MET) |
| Formula | C20H30N6O11PSR(C5H8O6PR)n |
| Reactions | OSR2562 OSR2663 |
| Pathways | |
|---|---|
| KEGG | rn00670 rn00970 rn00450 |
| Metacyc | TRNA-CHARGING-PWY |
| Database Links | |
|---|---|
| KEGG | C02430 |
| Pubchem Substance | 5457 |