RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2080 |
| Common Name | pelargonidin-3,5-diglucoside-5-O-caffeoylglucoside |
| Formula | C36H37O18 |
| Formula at pH 7.2 (Predicted) | C36H37O18 |
| Molecular Weight | 757.677 |
| Structure |  |
| SMILES | OCC1OC(OC2=Cc3c(cc(cc3[O]=C2c2ccc(cc2)O)O)OC2OC(COC(=O)C=Cc3ccc(c(c3)O)O)C(C(C2O)O)O)C(C(C1O)O)O |
| Reactions | OSR2842 |
| Database Links | |
|---|---|
| Gramene | CPD-7150 |