RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2082 |
| Common Name | all-trans-Hexaprenyl diphosphate |
| Formula | C30H52O7P2 |
| Formula at pH 7.2 (Predicted) | C30H50O7P22- |
| Molecular Weight | 586.677 |
| Structure |  |
| SMILES | CC(=CCCC(=CCCC(=CCOP(=O)(OP(=O)(O)O)O)C)C)CCC=C(CCC=C(CCC=C(C)C)C)C |
| Reactions | OSR2049 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01110 |
| Database Links | |
|---|---|
| KEGG | C01230 |
| ChEBI | 17528 |
| Pubchem Compound | 5280413 |
| Pubchem Substance | 4452 |