RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2090 |
| Common Name | Malonyl-CoA |
| Synonyms Names | Malonyl coenzyme A |
| Formula | C24H38N7O19P3S |
| Formula at pH 7.2 (Predicted) | C24H33N7O19P3S5- |
| Molecular Weight | 853.58 |
| Structure |  |
| SMILES | CC(C)(CO[P](O)(=O)O[P](O)(=O)OCC1OC(C(O)C1O[P](O)(O)=O)[N]2C=NC3=C2N=CN=C3N)C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)=O |
| Reactions | OSR1692 OSR1744 OSR2448 OSR2606 OSR2609 OSR2645 OSR2648 OSR2656 OSR2673 OSR2687 OSR2700 OSR2714 OSR2746 OSR2753 OSR2758 OSR2857 OSR2921 OSR2958 OSR2980 OSR3007 OSR3008 OSR3030 |
| Pathways | |
|---|---|
| KEGG | rn00410 rn00640 rn01100 rn00061 rn00941 rn01110 |
| Metacyc | FASYN-INITIAL-PWY PWY-282 PWY-84 PWY-5059 PWY-5080 PWY0-1264 PWY1F-FLAVSYN |
| Database Links | |
|---|---|
| KEGG | C00083 |
| ChEBI | 15531 |