RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2091 |
| Common Name | Propanoyl-CoA |
| Synonyms Names | Propionyl-CoA ;Propionyl coenzyme A |
| Formula | C24H40N7O17P3S |
| Formula at pH 7.2 (Predicted) | C24H36N7O17P3S4- |
| Molecular Weight | 823.597 |
| Structure |  |
| SMILES | CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO[P](O)(=O)O[P](O)(=O)OCC1OC(C(O)C1O[P](O)(O)=O)[N]2C=NC3=C2N=CN=C3N |
| Reactions | OSR1881 OSR1976 OSR2388 OSR2518 OSR2805 OSR2854 OSR2877 OSR2923 OSR3011 OSR3012 OSR3013 OSR3020 |
| Pathways | |
|---|---|
| KEGG | rn00640 rn01100 rn00280 rn00562 rn00410 rn01110 rn00120 |
| Metacyc | VALDEG-PWY PWY-5642 PWY-3941 PROPFERM-PWY |
| Database Links | |
|---|---|
| KEGG | C00100 |
| ChEBI | 15539 |