RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2095 |
| Common Name | 3-Hydroxypropionyl-CoA |
| Synonyms Names | 3-Hydroxypropionyl coenzyme A ;3-Hydroxypropanoyl-CoA ;3-Hydroxypropanoyl coenzymeA ;beta-Hydroxypropionyl-CoA |
| Formula | C24H40N7O18P3S |
| Formula at pH 7.2 (Predicted) | C24H36N7O18P3S4- |
| Molecular Weight | 839.597 |
| Structure |  |
| SMILES | c1(c2(c(ncn1)n(cn2)C3(OC(C(C(O)3)OP(O)(=O)O)COP(O)(=O)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)CCO)))(N) |
| Reactions | OSR1716 OSR1775 OSR2522 |
| Pathways | |
|---|---|
| KEGG | rn00410 rn00640 rn00720 rn01100 rn01120 |
| Metacyc | PWY-3941 |
| Database Links | |
|---|---|
| KEGG | C05668 |
| ChEBI | 27762 |
| Pubchem Compound | 440753 |
| Pubchem Substance | 7976 |