RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2097 |
| Common Name | Crotonoyl-CoA |
| Synonyms Names | Crotonyl-CoA ;2-Butenoyl-CoA ;trans-But-2-enoyl-CoA ;But-2-enoyl-CoA |
| Formula | C25H40N7O17P3S |
| Formula at pH 7.2 (Predicted) | C25H36N7O17P3S4- |
| Molecular Weight | 835.608 |
| Structure |  |
| SMILES | C1(OC(C(C(O)1)OP(O)(=O)O)COP(O)(=O)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC)(n2(c3(c(nc2)c(N)ncn3))) |
| Reactions | OSR1767 OSR1773 OSR1776 OSR1784 OSR2799 OSR2875 OSR2931 |
| Pathways | |
|---|---|
| KEGG | rn00071 rn00310 rn00362 rn00380 rn00627 rn00650 rn00720 rn01100 rn01120 |
| Metacyc | P3-PWY P127-PWY CENTFERM-PWY PWY-5177 |
| Database Links | |
|---|---|
| KEGG | C00877 |