RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2099 |
| Common Name | 3-HYDROXYACYL-COA |
| Formula | C24H39N7O18RP3S |
| Formula at pH 7.2 (Predicted) | C24H35O18N7P3S1R14- |
| Structure |  |
| SMILES | [H]C3(COP(=O)(O)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)[R])(OC([H])(n2(cnc1(c(N)ncnc12)))C([H])(O)C([H])(OP(=O)(O)O)3) |
| Reactions | OSR1704 OSR2808 |
| Pathways | |
|---|---|
| Metacyc | PWY-5080 |