RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2101 |
| Common Name | 3-Hexaprenyl-4-hydroxybenzoate |
| Synonyms Names | 3-Hexaprenyl-4-hydroxybenzoic acid |
| Formula | C37H54O3 |
| Formula at pH 7.2 (Predicted) | C37H53O3- |
| Molecular Weight | 546.823 |
| Structure |  |
| SMILES | CC(=CCCC(=CCCC(=CCc1cc(ccc1O)C(=O)O)C)C)CCC=C(CCC=C(CCC=C(C)C)C)C |
| Reactions | OSR2049 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01110 |
| Database Links | |
|---|---|
| KEGG | C13425 |
| ChEBI | 31116 |
| Pubchem Compound | 11954011 |
| Pubchem Substance | 586167 |