RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2104 |
| Common Name | Acetoacetyl-CoA |
| Synonyms Names | Acetoacetyl coenzyme A ;3-Acetoacetyl-CoA |
| Formula | C25H40N7O18P3S |
| Formula at pH 7.2 (Predicted) | C25H36N7O18P3S4- |
| Molecular Weight | 851.607 |
| Structure |  |
| SMILES | CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[CH]1(O[CH]([CH](O)[CH]1OP(O)(O)=O)n2(c3(c(nc2)c(N)ncn3))) |
| Reactions | OSR2449 OSR2802 OSR2822 OSR2830 OSR2831 OSR2902 |
| Pathways | |
|---|---|
| KEGG | rn00071 rn00072 rn00280 rn00310 rn00362 rn00380 rn00620 rn00630 rn00640 rn00650 rn00720 rn00900 rn01100 rn01110 rn01120 |
| Metacyc | P127-PWY PWY-922 CENTFERM-PWY PWY-5177 |
| Database Links | |
|---|---|
| KEGG | C00332 |
| ChEBI | 15345 |