RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2105 |
| Common Name | GLOBIN |
| Synonyms Names | C06258 |
| Formula | C25H40N6O17P2R2Se |
| Formula at pH 7.2 (Predicted) | C25H37O17N6P2R2Se4- |
| Structure |  |
| SMILES | C[Se]CCC(N)C(=O)OC1C(O)C(CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO)[R])[R])OC1[N]4C=NC5=C(N)N=CN=C45 |
| Reactions | OSR2993 |
| Pathways | |
|---|---|
| KEGG | rn00860 |
| Database Links | |
|---|---|
| KEGG | C06258 |
| Pubchem Substance | 8497 |