RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2108 |
| Common Name | 2-Hexaprenyl-6-methoxyphenol |
| Formula | C37H56O2 |
| Formula at pH 7.2 (Predicted) | C37H56O2 |
| Molecular Weight | 532.839 |
| Structure |  |
| SMILES | COc1cccc(c1O)CC=C(CCC=C(CCC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C)C)C |
| Reactions | OSR1817 |
| Pathways | |
|---|---|
| KEGG | rn00130 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05802 |
| ChEBI | 1109 |
| Pubchem Compound | 5280825 |
| Pubchem Substance | 8097 |