RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2109 |
| Common Name | Phoenicoxanthin |
| Synonyms Names | Adonirubin |
| Formula | C40H52O3 |
| Formula at pH 7.2 (Predicted) | C40H52O3 |
| Molecular Weight | 580.839 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1=C(C)C(=O)CCC1(C)C)C)C)C=CC=C(C=CC1=C(C)C(=O)C(CC1(C)C)O)C |
| Reactions | OSR1748 OSR1765 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Database Links | |
|---|---|
| KEGG | C15967 |
| Pubchem Compound | 16061231 |
| Pubchem Substance | 47205280 |