RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2114 |
| Common Name | Butanoyl-CoA |
| Synonyms Names | Butyryl-CoA |
| Formula | C25H42N7O17P3S |
| Formula at pH 7.2 (Predicted) | C25H38N7O17P3S4- |
| Molecular Weight | 837.624 |
| Structure |  |
| SMILES | [CH]3(n1(c2(c(nc1)c(N)ncn2)))(O[CH]([CH]([CH](O)3)OP(O)(O)=O)COP(O)(=O)OP(O)(=O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)CCC) |
| Reactions | OSR1776 OSR1964 OSR1968 OSR2799 OSR2875 OSR2888 OSR2931 |
| Pathways | |
|---|---|
| KEGG | rn00071 rn01100 rn00062 |
| Database Links | |
|---|---|
| KEGG | C00136 |
| ChEBI | 15517 |