RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2122 |
| Common Name | delphinidin 3,5,3'-triglucoside |
| Formula | C33H41O22 |
| Formula at pH 7.2 (Predicted) | C33H40O22 |
| Molecular Weight | 789.674 |
| Structure |  |
| SMILES | C1=C(C=C(C(=C1O)O)OC2C(C(C(C(O2)CO)O)O)O)C3=C(C=C4C(=CC(=O)C=C4OC5C(C(C(C(O5)CO)O)O)O)O3)OC6C(C(C(C(O6)CO)O)O)O |
| Reactions | OSR2464 OSR2939 |
| Pathways | |
|---|---|
| Metacyc | PWY-5307 |
| Database Links | |
|---|---|
| Gramene | CPD-7966 |