RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2123 |
| Common Name | Astaxanthin |
| Formula | C40H52O4 |
| Formula at pH 7.2 (Predicted) | C40H52O4 |
| Molecular Weight | 596.838 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1=C(C)C(=O)C(CC1(C)C)O)C)C)C=CC=C(C=CC1=C(C)C(=O)C(CC1(C)C)O)C |
| Reactions | OSR1765 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Database Links | |
|---|---|
| KEGG | C08580 |
| Pubchem Compound | 5281224 |
| Pubchem Substance | 10773 |