RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2132 |
| Common Name | 3-Methylcrotonyl-CoA |
| Synonyms Names | 3-Methylbut-2-enoyl-CoA ;3-Methylcrotonoyl-CoA ;Dimethylacryloyl-CoA |
| Formula | C26H42N7O17P3S |
| Formula at pH 7.2 (Predicted) | C26H38N7O17P3S4- |
| Molecular Weight | 849.635 |
| Structure |  |
| SMILES | [CH]3(n1(c2(c(nc1)c(N)ncn2)))(O[CH]([CH]([CH](O)3)OP(=O)(O)O)COP(=O)(O)OP(=O)(O)OCC(C)(C)C(O)C(=O)NCCC(=O)NCCSC(=O)C=C(C)C) |
| Reactions | OSR1862 OSR2580 OSR2890 |
| Pathways | |
|---|---|
| KEGG | rn00280 rn01100 |
| Metacyc | LEU-DEG2-PWY |
| Database Links | |
|---|---|
| KEGG | C03069 |
| ChEBI | 15486 |
| Pubchem Compound | 439869 |
| Pubchem Substance | 5969 |