RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2138 |
| Common Name | alpha-Cryptoxanthin |
| Synonyms Names | (3'R,6'R)-beta,epsilon-Caroten-3'-ol |
| Formula | C40H56O |
| Formula at pH 7.2 (Predicted) | C40H56O |
| Molecular Weight | 552.872 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C)C=CC=C(C=CC1C(=CC(CC1(C)C)O)C)C |
| Reactions | OSR1809 OSR1826 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Database Links | |
|---|---|
| KEGG | C15981 |
| Pubchem Compound | 23724629 |
| Pubchem Substance | 47205294 |