RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2139 |
| Common Name | beta-Cryptoxanthin |
| Formula | C40H56O |
| Formula at pH 7.2 (Predicted) | C40H56O |
| Molecular Weight | 552.872 |
| Structure |  |
| SMILES | CC(C=CC1(=C(C)CC(O)CC(C)(C)1))=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC2(C(C)(C)CCCC(C)=2) |
| Reactions | OSR1802 OSR1822 OSR1908 OSR1931 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Database Links | |
|---|---|
| Gramene | CPD-7409 |
| KEGG | C08591 |
| ChEBI | 10362 |
| Pubchem Compound | 5281235 |
| Pubchem Substance | 10784 |