RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2140 |
| Common Name | epsilon,epsilon-carotene-3-diol |
| Formula | C40H56O1 |
| Formula at pH 7.2 (Predicted) | C40H56O |
| Molecular Weight | 552.882 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1C(=CCCC1(C)C)C)C)C)C=CC=C(C=CC1C(=CC(CC1(C)C)O)C)C |
| Reactions | OSR1909 OSR1946 |
| Pathways | |
|---|---|
| Metacyc | PWY-5175 |
| Database Links | |
|---|---|
| Gramene | CPD-7415 |