RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2141 |
| Common Name | Trypanothione |
| Synonyms Names | N1,N8-Bis(gamma-L-glutamyl-L-cysteinyl-glycyl)spermidine ;N1,N8-Bis(glutathionyl)spermidine ;Reduced trypanothione |
| Formula | C27H49N9O10S2 |
| Formula at pH 7.2 (Predicted) | C27H50N9O10S2+ |
| Molecular Weight | 723.862 |
| Structure |  |
| SMILES | SCC(C(=O)NCC(=O)NCCCCNCCCNC(=O)CNC(=O)C(NC(=O)CCC(C(=O)O)N)CS)NC(=O)CCC(C(=O)O)N |
| Reactions | OSR2336 |
| Pathways | |
|---|---|
| KEGG | rn00480 rn01100 |
| Database Links | |
|---|---|
| KEGG | C02090 |
| ChEBI | 17842 |
| Pubchem Compound | 449517 |
| Pubchem Substance | 5175 |