RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2146 |
| Common Name | Neurosporene |
| Formula | C40H58 |
| Formula at pH 7.2 (Predicted) | C40H58 |
| Molecular Weight | 538.889 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C |
| Reactions | OSR1835 OSR1836 OSR1923 OSR1974 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Metacyc | CAROTENOID-PWY |
| Database Links | |
|---|---|
| KEGG | C05431 |
| ChEBI | 16833 |
| Pubchem Compound | 5280789 |
| Pubchem Substance | 7795 |