RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2147 |
| Common Name | 7,8-Dihydro-beta-carotene |
| Formula | C40H58 |
| Formula at pH 7.2 (Predicted) | C40H58 |
| Molecular Weight | 538.889 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C)C=CC=C(CCC1=C(C)CCCC1(C)C)C |
| Reactions | OSR1831 |
| Pathways | |
|---|---|
| KEGG | rn00906 |
| Database Links | |
|---|---|
| KEGG | C16291 |
| Pubchem Compound | 16061228 |
| Pubchem Substance | 47205599 |