RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2149 |
| Common Name | alpha-Zeacarotene |
| Formula | C40H58 |
| Formula at pH 7.2 (Predicted) | C40H58 |
| Molecular Weight | 538.889 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(C=CC1C(=CCCC1(C)C)C)C)C)C=CC=C(CCC=C(CCC=C(C)C)C)C |
| Reactions | OSR1813 OSR1836 |
| Database Links | |
|---|---|
| KEGG | C14146 |
| ChEBI | 35063 |
| Pubchem Compound | 5282344 |
| Pubchem Substance | 7846958 |