RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2154 |
| Common Name | Zeaxanthin |
| Formula | C40H56O2 |
| Formula at pH 7.2 (Predicted) | C40H56O2 |
| Molecular Weight | 568.871 |
| Structure |  |
| SMILES | CC(C=CC1(=C(C)CC(O)CC(C)(C)1))=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC2(C(C)(C)CC(O)CC(C)=2) |
| Reactions | OSR1552 OSR1822 OSR1931 OSR2256 OSR2833 OSR3002 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Metacyc | PWY-5397 PWY-1141 CAROTENOID-PWY |
| Database Links | |
|---|---|
| KEGG | C06098 |
| ChEBI | 27547 |
| Pubchem Compound | 5280899 |
| Pubchem Substance | 8363 |