RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2163 |
| Common Name | 5-formyl-tetrahydromethanopterin |
| Formula | C31H44N6O17P1 |
| Formula at pH 7.2 (Predicted) | C31H42N6O17P3- |
| Molecular Weight | 803.692 |
| Structure |  |
| SMILES | O=CN1C(C(Nc2ccc(cc2)CC(C(C(COC2OC(C(C2O)O)COP(=O)(OC(C(=O)O)CCC(=O)O)[O-])O)O)O)C)C(C)Nc2c1c(=O)[nH]c(n2)N |
| Reactions | OSR1870 OSR2801 |