RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2165 |
| Common Name | 3-Hydroxyisovaleryl-CoA |
| Synonyms Names | 3-Hydroxyisovaleryl coenzyme A |
| Formula | C26H44N7O18P3S |
| Formula at pH 7.2 (Predicted) | C26H40N7O18P3S4- |
| Molecular Weight | 867.65 |
| Structure |  |
| SMILES | O=C(NCCSC(=O)CC(O)(C)C)CCNC(=O)C(C(COP(=O)(OP(=O)(OCC1OC(C(C1OP(=O)(O)O)O)n1cnc2c1ncnc2N)O)O)(C)C)O |
| Reactions | OSR1862 |
| Pathways | |
|---|---|
| KEGG | rn00280 |
| Database Links | |
|---|---|
| KEGG | C05998 |
| ChEBI | 28291 |
| Pubchem Compound | 11953876 |
| Pubchem Substance | 8272 |