RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2170 |
| Common Name | 9,9'-Di-cis-zeta-carotene |
| Formula | C40H60 |
| Formula at pH 7.2 (Predicted) | C40H60 |
| Molecular Weight | 540.904 |
| Structure |  |
| SMILES | CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C=CC=C(CCC=C(CCC=C(C)C)C)C |
| Reactions | OSR1834 OSR1930 |
| Database Links | |
|---|---|
| KEGG | C15857 |
| ChEBI | 48716 |
| Pubchem Compound | 6440490 |
| Pubchem Substance | 47205177 |