RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2171 |
| Common Name | zeta-Carotene |
| Formula | C40H60 |
| Formula at pH 7.2 (Predicted) | C40H60 |
| Molecular Weight | 540.904 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C |
| Reactions | OSR1959 OSR1974 OSR2013 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05430 |
| ChEBI | 28068 |
| Pubchem Compound | 5280788 |
| Pubchem Substance | 7794 |