RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC2173 |
| Common Name | Violaxanthin |
| Synonyms Names | all-trans-Violaxanthin |
| Formula | C40H56O4 |
| Formula at pH 7.2 (Predicted) | C40H56O4 |
| Molecular Weight | 600.87 |
| Structure |  |
| SMILES | CC(C=CC12(C(C)(C)CC(O)CC(C)(O1)2))=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(O3)CC(O)CC(C)(C)4) |
| Reactions | OSR1882 OSR2269 OSR2840 OSR3004 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01100 rn01110 |
| Metacyc | PWY-1141 CAROTENOID-PWY |
| Database Links | |
|---|---|
| KEGG | C08614 |
| ChEBI | 35288 |
| Pubchem Compound | 448438 |
| Pubchem Substance | 10807 |